C19H19ClF2N5O6P — CID 175342012
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2-chloro-4,5-difluorophenyl)-1,3,2-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 175342012) has the molecular formula C19H19ClF2N5O6P and a molecular weight of 517.81 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2-chloro-4,5-difluorophenyl)-1,3,2-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2-chloro-4,5-difluorophenyl)-1,3,2-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 175342012 |
| Molecular Formula | C19H19ClF2N5O6P |
| Molecular Weight | 517.81 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2-chloro-4,5-difluorophenyl)-1,3,2-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP2OCCC(c3cc(F)c(F)cc3Cl)O2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19ClF2N5O6P/c20-9-4-11(22)10(21)3-8(9)12-1-2-30-34(33-12)31-5-13-15(28)16(29)19(32-13)27-7-26-14-17(23)24-6-25-18(14)27/h3-4,6-7,12-13,15-16,19,28-29H,1-2,5H2,(H2,23,24,25)/t12?,13-,15-,16-,19-,34?/m1/s1 |
| InChIKey | MMAGEYVOXXTESQ-YQHYMBIOSA-N |
| XLogP | 2.38 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|