C19H18ClF3N5O6PS — CID 154637177
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-chloro-2,4,5-trifluorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 154637177) has the molecular formula C19H18ClF3N5O6PS and a molecular weight of 567.87 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-chloro-2,4,5-trifluorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-chloro-2,4,5-trifluorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 154637177 |
| Molecular Formula | C19H18ClF3N5O6PS |
| Molecular Weight | 567.87 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-chloro-2,4,5-trifluorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP2(=S)OCCC(c3cc(F)c(F)c(Cl)c3F)O2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18ClF3N5O6PS/c20-11-12(22)7(3-8(21)13(11)23)9-1-2-31-35(36,34-9)32-4-10-15(29)16(30)19(33-10)28-6-27-14-17(24)25-5-26-18(14)28/h3,5-6,9-10,15-16,19,29-30H,1-2,4H2,(H2,24,25,26)/t9?,10-,15-,16-,19-,35?/m1/s1 |
| InChIKey | PQPJPUGJKFUNKV-NYDBMGHXSA-N |
| XLogP | 2.52 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|