C16H24N5O4PS3 — CID 59637482
9-[(2R,5S)-3,4-dimethyl-5-[(2-sulfanylidene-1,3,6,7,2λ5-dioxadithiaphosphonan-2-yl)oxymethyl]oxolan-2-yl]purin-6-amine (PubChem CID 59637482) has the molecular formula C16H24N5O4PS3 and a molecular weight of 477.57 g/mol. Its IUPAC name is 9-[(2R,5S)-3,4-dimethyl-5-[(2-sulfanylidene-1,3,6,7,2λ5-dioxadithiaphosphonan-2-yl)oxymethyl]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,5S)-3,4-dimethyl-5-[(2-sulfanylidene-1,3,6,7,2λ5-dioxadithiaphosphonan-2-yl)oxymethyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 59637482 |
| Molecular Formula | C16H24N5O4PS3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 9-[(2R,5S)-3,4-dimethyl-5-[(2-sulfanylidene-1,3,6,7,2λ5-dioxadithiaphosphonan-2-yl)oxymethyl]oxolan-2-yl]purin-6-amine |
| SMILES | CC1C(C)[C@@H](COP2(=S)OCCSSCCO2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H24N5O4PS3/c1-10-11(2)16(21-9-20-13-14(17)18-8-19-15(13)21)25-12(10)7-24-26(27)22-3-5-28-29-6-4-23-26/h8-12,16H,3-7H2,1-2H3,(H2,17,18,19)/t10?,11?,12-,16-/m1/s1 |
| InChIKey | CBQCBYCYTPYOFR-CUJYKCCASA-N |
| XLogP | 3.25 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|