C16H20N5O7PS2 — CID 102348810
[(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)oxymethyl]oxolan-3-yl] acetate (PubChem CID 102348810) has the molecular formula C16H20N5O7PS2 and a molecular weight of 489.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102348810 |
| Molecular Formula | C16H20N5O7PS2 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-2-[(2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl)oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](COP2(=S)OCCS2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H20N5O7PS2/c1-8(22)26-12-10(5-25-29(30)24-3-4-31-29)28-16(13(12)27-9(2)23)21-7-20-11-14(17)18-6-19-15(11)21/h6-7,10,12-13,16H,3-5H2,1-2H3,(H2,17,18,19)/t10-,12-,13-,16-,29?/m1/s1 |
| InChIKey | XPGCLTFSOHUOBM-LQCNHLKASA-N |
| XLogP | 1.17 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|