C11H15N7O3 — CID 166980118
9-[3-amino-4-methoxy-5-(nitrosomethyl)oxolan-2-yl]purin-6-amine (PubChem CID 166980118) has the molecular formula C11H15N7O3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 9-[3-amino-4-methoxy-5-(nitrosomethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[3-amino-4-methoxy-5-(nitrosomethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 166980118 |
| Molecular Formula | C11H15N7O3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 9-[3-amino-4-methoxy-5-(nitrosomethyl)oxolan-2-yl]purin-6-amine |
| SMILES | COC1C(CN=O)OC(n2cnc3c(N)ncnc32)C1N |
| InChI | InChI=1S/C11H15N7O3/c1-20-8-5(2-17-19)21-11(6(8)12)18-4-16-7-9(13)14-3-15-10(7)18/h3-6,8,11H,2,12H2,1H3,(H2,13,14,15) |
| InChIKey | YRRDZIIBFKRGPV-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |