C16H22FN6O7P — CID 162510775
[(2R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid (PubChem CID 162510775) has the molecular formula C16H22FN6O7P and a molecular weight of 460.36 g/mol. Its IUPAC name is [(2R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid.
| Compound Name | [(2R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
|---|---|
| PubChem CID | 162510775 |
| Molecular Formula | C16H22FN6O7P |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [(2R,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methoxy-morpholin-4-ylphosphinic acid |
| SMILES | CC(=O)O[C@H]1C(F)[C@@H](COP(=O)(O)N2CCOCC2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H22FN6O7P/c1-9(24)29-13-11(17)10(6-28-31(25,26)22-2-4-27-5-3-22)30-16(13)23-8-21-12-14(18)19-7-20-15(12)23/h7-8,10-11,13,16H,2-6H2,1H3,(H,25,26)(H2,18,19,20)/t10-,11?,13+,16-/m1/s1 |
| InChIKey | VHRVXTRLJZRSBV-JOPIULRKSA-N |
| XLogP | 0.02 |
| TPSA | 164.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|