C13H19N4O7P — CID 59796139
[(2R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]oxymethylphosphonic acid (PubChem CID 59796139) has the molecular formula C13H19N4O7P and a molecular weight of 374.29 g/mol. Its IUPAC name is [(2R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 59796139 |
| Molecular Formula | C13H19N4O7P |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [(2R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]oxymethylphosphonic acid |
| SMILES | C[C@]1(OCP(=O)(O)O)O[C@@H](n2ccc3c(N)ncnc32)[C@](C)(O)C1O |
| InChI | InChI=1S/C13H19N4O7P/c1-12(19)10(18)13(2,23-6-25(20,21)22)24-11(12)17-4-3-7-8(14)15-5-16-9(7)17/h3-5,10-11,18-19H,6H2,1-2H3,(H2,14,15,16)(H2,20,21,22)/t10?,11-,12-,13+/m1/s1 |
| InChIKey | RLDWRVXMMUDXPY-HYWTVENDSA-N |
| XLogP | -0.48 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|