C24H31N4O7P — CID 90348023
(3S)-3-[[1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butan-2-one (PubChem CID 90348023) has the molecular formula C24H31N4O7P and a molecular weight of 518.51 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butan-2-one.
| Compound Name | (3S)-3-[[1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butan-2-one |
|---|---|
| PubChem CID | 90348023 |
| Molecular Formula | C24H31N4O7P |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (3S)-3-[[1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butan-2-one |
| SMILES | CC(=O)[C@H](C)NP(=O)(Oc1ccccc1)OC(C)[C@H]1O[C@@H](n2ccc3c(N)ccnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C24H31N4O7P/c1-14(15(2)29)27-36(32,35-17-8-6-5-7-9-17)34-16(3)20-21(30)24(4,31)23(33-20)28-13-11-18-19(25)10-12-26-22(18)28/h5-14,16,20-21,23,30-31H,1-4H3,(H2,25,26)(H,27,32)/t14-,16?,20+,21+,23+,24+,36?/m0/s1 |
| InChIKey | CBPAEZCGAPSBIG-OUFRROOXSA-N |
| XLogP | 2.79 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|