C21H28FN4O8PS — CID 130179298
propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-amino-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 130179298) has the molecular formula C21H28FN4O8PS and a molecular weight of 546.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-amino-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-amino-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 130179298 |
| Molecular Formula | C21H28FN4O8PS |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5R)-2-amino-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=S)(OC[C@@]1(N)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1F)Oc1ccccc1 |
| InChI | InChI=1S/C21H28FN4O8PS/c1-12(2)32-19(29)13(3)25-35(36,34-14-7-5-4-6-8-14)31-11-21(23)17(22)16(28)18(33-21)26-10-9-15(27)24-20(26)30/h4-10,12-13,16-18,28H,11,23H2,1-3H3,(H,25,36)(H,24,27,30)/t13-,16+,17-,18+,21+,35?/m0/s1 |
| InChIKey | DYVGNRBTFGSWNQ-PADFXURYSA-N |
| XLogP | 0.67 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|