C26H31N6O6P — CID 163500042
benzyl (2S)-2-[[[(5R)-5-(6-amino-4,5-dihydropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163500042) has the molecular formula C26H31N6O6P and a molecular weight of 554.54 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(5R)-5-(6-amino-4,5-dihydropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(5R)-5-(6-amino-4,5-dihydropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163500042 |
| Molecular Formula | C26H31N6O6P |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | benzyl (2S)-2-[[[(5R)-5-(6-amino-4,5-dihydropurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OCC1CC[C@H](N2C=NC3C(N)=NC=NC32)O1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31N6O6P/c1-18(26(33)35-14-19-8-4-2-5-9-19)31-39(34,38-20-10-6-3-7-11-20)36-15-21-12-13-22(37-21)32-17-30-23-24(27)28-16-29-25(23)32/h2-11,16-18,21-23,25H,12-15H2,1H3,(H,31,34)(H2,27,28,29)/t18-,21?,22+,23?,25?,39?/m0/s1 |
| InChIKey | CTYJWTFQEVTOHD-NVSBOMBSSA-N |
| XLogP | 2.85 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|