C15H18N5O5P — CID 90429462
2-(2-amino-6-oxo-5H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphinic acid (PubChem CID 90429462) has the molecular formula C15H18N5O5P and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-5H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphinic acid.
| Compound Name | 2-(2-amino-6-oxo-5H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 90429462 |
| Molecular Formula | C15H18N5O5P |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-(2-amino-6-oxo-5H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphinic acid |
| SMILES | NC1=NC(=O)C2N=CN(CCOCP(=O)(O)OCc3ccccc3)C2=N1 |
| InChI | InChI=1S/C15H18N5O5P/c16-15-18-13-12(14(21)19-15)17-9-20(13)6-7-24-10-26(22,23)25-8-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2,(H,22,23)(H2,16,19,21) |
| InChIKey | WHVJDDBTYKRXNG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|