C14H21ClN5O5P — CID 18664209
6-chloro-9-[[(2S,4R)-2-(diethoxyphosphorylmethyl)-1,3-dioxolan-4-yl]methyl]purin-2-amine (PubChem CID 18664209) has the molecular formula C14H21ClN5O5P and a molecular weight of 405.78 g/mol. Its IUPAC name is 6-chloro-9-[[(2S,4R)-2-(diethoxyphosphorylmethyl)-1,3-dioxolan-4-yl]methyl]purin-2-amine.
| Compound Name | 6-chloro-9-[[(2S,4R)-2-(diethoxyphosphorylmethyl)-1,3-dioxolan-4-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 18664209 |
| Molecular Formula | C14H21ClN5O5P |
| Molecular Weight | 405.78 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 6-chloro-9-[[(2S,4R)-2-(diethoxyphosphorylmethyl)-1,3-dioxolan-4-yl]methyl]purin-2-amine |
| SMILES | CCOP(=O)(C[C@H]1OC[C@@H](Cn2cnc3c(Cl)nc(N)nc32)O1)OCC |
| InChI | InChI=1S/C14H21ClN5O5P/c1-3-23-26(21,24-4-2)7-10-22-6-9(25-10)5-20-8-17-11-12(15)18-14(16)19-13(11)20/h8-10H,3-7H2,1-2H3,(H2,16,18,19)/t9-,10+/m1/s1 |
| InChIKey | WNHGSWPPPFNZLK-ZJUUUORDSA-N |
| XLogP | 2.07 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|