C16H22ClN5O4 — CID 10548027
cis-ethyl (1R,4R)-4-(2-amino-6-chloropurin-9-yl)-2,2-diethoxycyclobutane-1-carboxylate (PubChem CID 10548027) has the molecular formula C16H22ClN5O4 and a molecular weight of 383.84 g/mol. Its IUPAC name is cis-ethyl (1R,4R)-4-(2-amino-6-chloropurin-9-yl)-2,2-diethoxycyclobutane-1-carboxylate.
| Compound Name | cis-ethyl (1R,4R)-4-(2-amino-6-chloropurin-9-yl)-2,2-diethoxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 10548027 |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | cis-ethyl (1R,4R)-4-(2-amino-6-chloropurin-9-yl)-2,2-diethoxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](n2cnc3c(Cl)nc(N)nc32)CC1(OCC)OCC |
| InChI | InChI=1S/C16H22ClN5O4/c1-4-24-14(23)10-9(7-16(10,25-5-2)26-6-3)22-8-19-11-12(17)20-15(18)21-13(11)22/h8-10H,4-7H2,1-3H3,(H2,18,20,21)/t9-,10+/m1/s1 |
| InChIKey | MQURERRMPMDJRD-ZJUUUORDSA-N |
| XLogP | 1.96 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|