C14H15ClN6O — CID 142213277
(3R,6S)-3-(2-amino-6-chloropurin-9-yl)-9-azatricyclo[4.3.1.01,4]decan-8-one (PubChem CID 142213277) has the molecular formula C14H15ClN6O and a molecular weight of 318.77 g/mol. Its IUPAC name is (3R,6S)-3-(2-amino-6-chloropurin-9-yl)-9-azatricyclo[4.3.1.01,4]decan-8-one.
| Compound Name | (3R,6S)-3-(2-amino-6-chloropurin-9-yl)-9-azatricyclo[4.3.1.01,4]decan-8-one |
|---|---|
| PubChem CID | 142213277 |
| Molecular Formula | C14H15ClN6O |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (3R,6S)-3-(2-amino-6-chloropurin-9-yl)-9-azatricyclo[4.3.1.01,4]decan-8-one |
| SMILES | Nc1nc(Cl)c2ncn([C@@H]3CC45C[C@@H](CC(=O)N4)CC35)c2n1 |
| InChI | InChI=1S/C14H15ClN6O/c15-11-10-12(19-13(16)18-11)21(5-17-10)8-4-14-3-6(1-7(8)14)2-9(22)20-14/h5-8H,1-4H2,(H,20,22)(H2,16,18,19)/t6-,7?,8-,14?/m1/s1 |
| InChIKey | YAQIBNLLYHWCGN-CASBPOJMSA-N |
| XLogP | 1.29 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |