C13H13ClN6O5 — CID 135048576
ethyl 2-[(2S,5R)-5-(2-amino-6-chloropurin-9-yl)-2,5-dihydrofuran-2-yl]-2-nitroacetate (PubChem CID 135048576) has the molecular formula C13H13ClN6O5 and a molecular weight of 368.74 g/mol. Its IUPAC name is ethyl 2-[(2S,5R)-5-(2-amino-6-chloropurin-9-yl)-2,5-dihydrofuran-2-yl]-2-nitroacetate.
| Compound Name | ethyl 2-[(2S,5R)-5-(2-amino-6-chloropurin-9-yl)-2,5-dihydrofuran-2-yl]-2-nitroacetate |
|---|---|
| PubChem CID | 135048576 |
| Molecular Formula | C13H13ClN6O5 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | ethyl 2-[(2S,5R)-5-(2-amino-6-chloropurin-9-yl)-2,5-dihydrofuran-2-yl]-2-nitroacetate |
| SMILES | CCOC(=O)C([C@@H]1C=C[C@H](n2cnc3c(Cl)nc(N)nc32)O1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClN6O5/c1-2-24-12(21)9(20(22)23)6-3-4-7(25-6)19-5-16-8-10(14)17-13(15)18-11(8)19/h3-7,9H,2H2,1H3,(H2,15,17,18)/t6-,7+,9?/m0/s1 |
| InChIKey | HVGNZFPMBVGWCB-PMDVUHRTSA-N |
| XLogP | 0.72 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|