C17H22ClN5O6 — CID 174540561
4-(2-amino-6-chloropurin-9-yl)-7-ethoxy-6-ethoxycarbonyl-7-oxoheptanoic acid (PubChem CID 174540561) has the molecular formula C17H22ClN5O6 and a molecular weight of 427.85 g/mol. Its IUPAC name is 4-(2-amino-6-chloropurin-9-yl)-7-ethoxy-6-ethoxycarbonyl-7-oxoheptanoic acid.
| Compound Name | 4-(2-amino-6-chloropurin-9-yl)-7-ethoxy-6-ethoxycarbonyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 174540561 |
| Molecular Formula | C17H22ClN5O6 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-(2-amino-6-chloropurin-9-yl)-7-ethoxy-6-ethoxycarbonyl-7-oxoheptanoic acid |
| SMILES | CCOC(=O)C(CC(CCC(=O)O)n1cnc2c(Cl)nc(N)nc21)C(=O)OCC |
| InChI | InChI=1S/C17H22ClN5O6/c1-3-28-15(26)10(16(27)29-4-2)7-9(5-6-11(24)25)23-8-20-12-13(18)21-17(19)22-14(12)23/h8-10H,3-7H2,1-2H3,(H,24,25)(H2,19,21,22) |
| InChIKey | LQCZBROFLXCLSH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|