C15H22N6O2S — CID 170721866
S-[[5-[6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine (PubChem CID 170721866) has the molecular formula C15H22N6O2S and a molecular weight of 350.45 g/mol. Its IUPAC name is S-[[5-[6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine.
| Compound Name | S-[[5-[6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
|---|---|
| PubChem CID | 170721866 |
| Molecular Formula | C15H22N6O2S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | S-[[5-[6-(cyclopentylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
| SMILES | NSOCC1CCC(n2cnc3c(NC4CCCC4)ncnc32)O1 |
| InChI | InChI=1S/C15H22N6O2S/c16-24-22-7-11-5-6-12(23-11)21-9-19-13-14(17-8-18-15(13)21)20-10-3-1-2-4-10/h8-12H,1-7,16H2,(H,17,18,20) |
| InChIKey | FXINNERDGOHENE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|