C16H20N6O2S2 — CID 170721872
S-[[5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine (PubChem CID 170721872) has the molecular formula C16H20N6O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is S-[[5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine.
| Compound Name | S-[[5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
|---|---|
| PubChem CID | 170721872 |
| Molecular Formula | C16H20N6O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | S-[[5-[6-(2-thiophen-2-ylethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
| SMILES | NSOCC1CCC(n2cnc3c(NCCc4cccs4)ncnc32)O1 |
| InChI | InChI=1S/C16H20N6O2S2/c17-26-23-8-11-3-4-13(24-11)22-10-21-14-15(19-9-20-16(14)22)18-6-5-12-2-1-7-25-12/h1-2,7,9-11,13H,3-6,8,17H2,(H,18,19,20) |
| InChIKey | VUTZOMQGHWDYIF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|