C15H22N6O3S — CID 170721853
S-[[5-[6-(oxolan-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine (PubChem CID 170721853) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is S-[[5-[6-(oxolan-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine.
| Compound Name | S-[[5-[6-(oxolan-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
|---|---|
| PubChem CID | 170721853 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | S-[[5-[6-(oxolan-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methoxy]thiohydroxylamine |
| SMILES | NSOCC1CCC(n2cnc3c(NCC4CCCO4)ncnc32)O1 |
| InChI | InChI=1S/C15H22N6O3S/c16-25-23-7-11-3-4-12(24-11)21-9-20-13-14(18-8-19-15(13)21)17-6-10-2-1-5-22-10/h8-12H,1-7,16H2,(H,17,18,19) |
| InChIKey | AYNRBYHYTDTTBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|