C24H25FN5O6P — CID 144900626
[5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite (PubChem CID 144900626) has the molecular formula C24H25FN5O6P and a molecular weight of 529.47 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite.
| Compound Name | [5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
|---|---|
| PubChem CID | 144900626 |
| Molecular Formula | C24H25FN5O6P |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl bis(4-methoxyphenyl) phosphite |
| SMILES | COc1ccc(OP(OCC2CC(F)C(n3cnc4c(N)ncnc43)O2)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H25FN5O6P/c1-31-15-3-7-17(8-4-15)35-37(36-18-9-5-16(32-2)6-10-18)33-12-19-11-20(25)24(34-19)30-14-29-21-22(26)27-13-28-23(21)30/h3-10,13-14,19-20,24H,11-12H2,1-2H3,(H2,26,27,28) |
| InChIKey | QPRNONDUVBBTPP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|