C28H29ClN8O3S — CID 172576938
N-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methylsulfanyl]ethyl]-2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 172576938) has the molecular formula C28H29ClN8O3S and a molecular weight of 593.11 g/mol. Its IUPAC name is N-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methylsulfanyl]ethyl]-2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methylsulfanyl]ethyl]-2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 172576938 |
| Molecular Formula | C28H29ClN8O3S |
| Molecular Weight | 593.11 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | N-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methylsulfanyl]ethyl]-2-(4-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(-c3ccc(Cl)cc3)nc(NCCSCC3CCC(n4cnc5c(N)ncnc54)O3)c2cc1OC |
| InChI | InChI=1S/C28H29ClN8O3S/c1-38-21-11-19-20(12-22(21)39-2)35-26(16-3-5-17(29)6-4-16)36-27(19)31-9-10-41-13-18-7-8-23(40-18)37-15-34-24-25(30)32-14-33-28(24)37/h3-6,11-12,14-15,18,23H,7-10,13H2,1-2H3,(H2,30,32,33)(H,31,35,36) |
| InChIKey | DYTXZNCEGOYQHK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.11 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|