C31H36IN7O7S — CID 172576908
(2S,3S,4R,5R)-2-[2-[[2-[3-[hydroxymethyl(methoxy)-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-yl]amino]ethylsulfanylmethyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol (PubChem CID 172576908) has the molecular formula C31H36IN7O7S and a molecular weight of 777.64 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[2-[[2-[3-[hydroxymethyl(methoxy)-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-yl]amino]ethylsulfanylmethyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[2-[[2-[3-[hydroxymethyl(methoxy)-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-yl]amino]ethylsulfanylmethyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 172576908 |
| Molecular Formula | C31H36IN7O7S |
| Molecular Weight | 777.64 g/mol |
| Exact Mass | 777.14 |
| IUPAC Name | (2S,3S,4R,5R)-2-[2-[[2-[3-[hydroxymethyl(methoxy)-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-yl]amino]ethylsulfanylmethyl]-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
| SMILES | COc1cc2nc(-c3cccc(I(CO)OC)c3)nc(NCCSC[C@H]3O[C@@H](n4cnc5c(C)ncnc54)[C@H](O)[C@@H]3O)c2cc1OC |
| InChI | InChI=1S/C31H36IN7O7S/c1-17-25-30(35-15-34-17)39(16-36-25)31-27(42)26(41)24(46-31)13-47-9-8-33-29-20-11-22(43-2)23(44-3)12-21(20)37-28(38-29)18-6-5-7-19(10-18)32(14-40)45-4/h5-7,10-12,15-16,24,26-27,31,40-42H,8-9,13-14H2,1-4H3,(H,33,37,38)/t24-,26-,27-,31-/m1/s1 |
| InChIKey | CSVOWJIVLPZZSI-YUGARCTCSA-N |
| XLogP | 3.41 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|