C23H26N8O3S — CID 177379621
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[2-[(3-pyrimidin-5-ylphenyl)methylamino]ethylsulfanylmethyl]oxolane-3,4-diol (PubChem CID 177379621) has the molecular formula C23H26N8O3S and a molecular weight of 494.58 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[2-[(3-pyrimidin-5-ylphenyl)methylamino]ethylsulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[2-[(3-pyrimidin-5-ylphenyl)methylamino]ethylsulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 177379621 |
| Molecular Formula | C23H26N8O3S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[2-[(3-pyrimidin-5-ylphenyl)methylamino]ethylsulfanylmethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCCNCc2cccc(-c3cncnc3)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H26N8O3S/c24-21-18-22(29-12-28-21)31(13-30-18)23-20(33)19(32)17(34-23)10-35-5-4-25-7-14-2-1-3-15(6-14)16-8-26-11-27-9-16/h1-3,6,8-9,11-13,17,19-20,23,25,32-33H,4-5,7,10H2,(H2,24,28,29)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | FCFWTYCVBCBOQB-ZDXOVATRSA-N |
| XLogP | 1.01 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|