C24H29N9O4S — CID 118726601
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]butanamide (PubChem CID 118726601) has the molecular formula C24H29N9O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]butanamide.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 118726601 |
| Molecular Formula | C24H29N9O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]butanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)NCc2cc(-c3ccccc3)n[nH]2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H29N9O4S/c25-15(23(36)27-9-14-8-16(32-31-14)13-4-2-1-3-5-13)6-7-38-10-17-19(34)20(35)24(37-17)33-12-30-18-21(26)28-11-29-22(18)33/h1-5,8,11-12,15,17,19-20,24,34-35H,6-7,9-10,25H2,(H,27,36)(H,31,32)(H2,26,28,29)/t15-,17+,19+,20+,24+/m0/s1 |
| InChIKey | RFDAVSSCZOJXSE-VQNOAORESA-N |
| XLogP | 0.18 |
| TPSA | 203.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|