C15H24Br2N5O10P3 — CID 88958813
[dibromo-[[[5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid (PubChem CID 88958813) has the molecular formula C15H24Br2N5O10P3 and a molecular weight of 687.11 g/mol. Its IUPAC name is [dibromo-[[[5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid.
| Compound Name | [dibromo-[[[5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 88958813 |
| Molecular Formula | C15H24Br2N5O10P3 |
| Molecular Weight | 687.11 g/mol |
| Exact Mass | 684.91 |
| IUPAC Name | [dibromo-[[[5-[6-(diethylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid |
| SMILES | CCN(CC)c1ncnc2c1ncn2C1CCC(COP(=O)(O)OP(=O)(O)C(Br)(Br)P(=O)(O)O)O1 |
| InChI | InChI=1S/C15H24Br2N5O10P3/c1-3-21(4-2)13-12-14(19-8-18-13)22(9-20-12)11-6-5-10(31-11)7-30-35(28,29)32-34(26,27)15(16,17)33(23,24)25/h8-11H,3-7H2,1-2H3,(H,26,27)(H,28,29)(H2,23,24,25) |
| InChIKey | GOZIDUCVJNEHGF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|