C15H24Br2N5O12P3 — CID 169433729
[dibromo-[[[(2S,3R,4S,5S)-5-[6-(diethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid (PubChem CID 169433729) has the molecular formula C15H24Br2N5O12P3 and a molecular weight of 719.11 g/mol. Its IUPAC name is [dibromo-[[[(2S,3R,4S,5S)-5-[6-(diethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid.
| Compound Name | [dibromo-[[[(2S,3R,4S,5S)-5-[6-(diethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 169433729 |
| Molecular Formula | C15H24Br2N5O12P3 |
| Molecular Weight | 719.11 g/mol |
| Exact Mass | 716.90 |
| IUPAC Name | [dibromo-[[[(2S,3R,4S,5S)-5-[6-(diethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methyl]phosphonic acid |
| SMILES | CCN(CC)c1ncnc2c1ncn2[C@H]1O[C@@H](COP(=O)(O)OP(=O)(O)C(Br)(Br)P(=O)(O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24Br2N5O12P3/c1-3-21(4-2)12-9-13(19-6-18-12)22(7-20-9)14-11(24)10(23)8(33-14)5-32-37(30,31)34-36(28,29)15(16,17)35(25,26)27/h6-8,10-11,14,23-24H,3-5H2,1-2H3,(H,28,29)(H,30,31)(H2,25,26,27)/t8-,10-,11-,14-/m0/s1 |
| InChIKey | ILXFKEOLRYLPJG-AEHQLWAISA-N |
| XLogP | 1.19 |
| TPSA | 247.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.11 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|