C26H46N5O7P — CID 174467446
[(2R,3S,4R,5R)-5-[6-[bis(2-ethylhexyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 174467446) has the molecular formula C26H46N5O7P and a molecular weight of 571.66 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-[bis(2-ethylhexyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-[bis(2-ethylhexyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174467446 |
| Molecular Formula | C26H46N5O7P |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-[bis(2-ethylhexyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H46N5O7P/c1-5-9-11-18(7-3)13-30(14-19(8-4)12-10-6-2)24-21-25(28-16-27-24)31(17-29-21)26-23(33)22(32)20(38-26)15-37-39(34,35)36/h16-20,22-23,26,32-33H,5-15H2,1-4H3,(H2,34,35,36)/t18?,19?,20-,22-,23-,26-/m1/s1 |
| InChIKey | UESUZGKQSFRPNI-IIJVVFPFSA-N |
| XLogP | 3.79 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|