C13H19N4O8P — CID 11111915
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1-propylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 11111915) has the molecular formula C13H19N4O8P and a molecular weight of 390.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1-propylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1-propylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11111915 |
| Molecular Formula | C13H19N4O8P |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1-propylpurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCn1cnc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C13H19N4O8P/c1-2-3-16-5-15-11-8(12(16)20)14-6-17(11)13-10(19)9(18)7(25-13)4-24-26(21,22)23/h5-7,9-10,13,18-19H,2-4H2,1H3,(H2,21,22,23)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | ITFACVCPELQITF-QYVSTXNMSA-N |
| XLogP | -1.27 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|