C16H26N5O8P — CID 45378892
[(2R,3S,4R,5R)-5-[1-(6-aminohexyl)-6-oxopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 45378892) has the molecular formula C16H26N5O8P and a molecular weight of 447.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[1-(6-aminohexyl)-6-oxopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[1-(6-aminohexyl)-6-oxopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 45378892 |
| Molecular Formula | C16H26N5O8P |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[1-(6-aminohexyl)-6-oxopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NCCCCCCn1cnc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C16H26N5O8P/c17-5-3-1-2-4-6-20-8-19-14-11(15(20)24)18-9-21(14)16-13(23)12(22)10(29-16)7-28-30(25,26)27/h8-10,12-13,16,22-23H,1-7,17H2,(H2,25,26,27)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | GIFKCJQYZZDVNM-XNIJJKJLSA-N |
| XLogP | -1.16 |
| TPSA | 195.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|