C25H33N6O4P — CID 88553014
3-[[(2R,5R)-2-(deuteriomethyl)-5-(6-phenoxypurin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 88553014) has the molecular formula C25H33N6O4P and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-[[(2R,5R)-2-(deuteriomethyl)-5-(6-phenoxypurin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,5R)-2-(deuteriomethyl)-5-(6-phenoxypurin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 88553014 |
| Molecular Formula | C25H33N6O4P |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 3-[[(2R,5R)-2-(deuteriomethyl)-5-(6-phenoxypurin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | [2H]C[C@H]1O[C@@H](n2cnc3c(Oc4ccccc4)ncnc32)CC1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C25H33N6O4P/c1-17(2)31(18(3)4)36(32-13-9-12-26)35-21-14-22(33-19(21)5)30-16-29-23-24(30)27-15-28-25(23)34-20-10-7-6-8-11-20/h6-8,10-11,15-19,21-22H,9,13-14H2,1-5H3/t19-,21?,22-,36?/m1/s1/i5D |
| InChIKey | UEVZGECXOODQKU-DYYQGBRXSA-N |
| XLogP | 5.59 |
| TPSA | 107.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|