C31H47N6O5PSi — CID 88980631
3-[[(2R,3R,4R,5R)-2-(deuteriomethyl)-4-phenylmethoxy-5-[6-(2-trimethylsilylethoxy)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 88980631) has the molecular formula C31H47N6O5PSi and a molecular weight of 643.82 g/mol. Its IUPAC name is 3-[[(2R,3R,4R,5R)-2-(deuteriomethyl)-4-phenylmethoxy-5-[6-(2-trimethylsilylethoxy)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3R,4R,5R)-2-(deuteriomethyl)-4-phenylmethoxy-5-[6-(2-trimethylsilylethoxy)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 88980631 |
| Molecular Formula | C31H47N6O5PSi |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 3-[[(2R,3R,4R,5R)-2-(deuteriomethyl)-4-phenylmethoxy-5-[6-(2-trimethylsilylethoxy)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | [2H]C[C@H]1O[C@@H](n2cnc3c(OCC[Si](C)(C)C)ncnc32)[C@H](OCc2ccccc2)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C31H47N6O5PSi/c1-22(2)37(23(3)4)43(40-16-12-15-32)42-27-24(5)41-31(28(27)39-19-25-13-10-9-11-14-25)36-21-35-26-29(36)33-20-34-30(26)38-17-18-44(6,7)8/h9-11,13-14,20-24,27-28,31H,12,16-19H2,1-8H3/t24-,27-,28-,31-,43?/m1/s1/i5D |
| InChIKey | SFOGAWYLBBEBKC-NMUOPRIUSA-N |
| XLogP | 6.71 |
| TPSA | 116.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|