C23H38N5O5P — CID 161394668
N-[but-3-ynoxy-[2-(deuteriomethyl)-4-methoxy-5-(6-methylpurin-9-yl)oxolan-3-yl]oxyphosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane (PubChem CID 161394668) has the molecular formula C23H38N5O5P and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[but-3-ynoxy-[2-(deuteriomethyl)-4-methoxy-5-(6-methylpurin-9-yl)oxolan-3-yl]oxyphosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane.
| Compound Name | N-[but-3-ynoxy-[2-(deuteriomethyl)-4-methoxy-5-(6-methylpurin-9-yl)oxolan-3-yl]oxyphosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane |
|---|---|
| PubChem CID | 161394668 |
| Molecular Formula | C23H38N5O5P |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | N-[but-3-ynoxy-[2-(deuteriomethyl)-4-methoxy-5-(6-methylpurin-9-yl)oxolan-3-yl]oxyphosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane |
| SMILES | [2H]CC1OC(n2cnc3c(C)ncnc32)C(OC)C1OP(OCCC#C)N(C(C)C)C(C)C.[3H]OC |
| InChI | InChI=1S/C22H34N5O4P.CH4O/c1-9-10-11-29-32(27(14(2)3)15(4)5)31-19-17(7)30-22(20(19)28-8)26-13-25-18-16(6)23-12-24-21(18)26;1-2/h1,12-15,17,19-20,22H,10-11H2,2-8H3;2H,1H3/i7D;2T |
| InChIKey | VTLDKPVHRVDPRS-CEJSKEKJSA-N |
| XLogP | 3.45 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|