C27H39N8O3P — CID 142844153
N'-[1-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-4-methylcyclopentyl]-3-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 142844153) has the molecular formula C27H39N8O3P and a molecular weight of 554.64 g/mol. Its IUPAC name is N'-[1-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-4-methylcyclopentyl]-3-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-4-methylcyclopentyl]-3-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 142844153 |
| Molecular Formula | C27H39N8O3P |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | N'-[1-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-4-methylcyclopentyl]-3-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CC1CC(n2nc(-c3ccco3)c3c(/N=C\N(C)C)ncnc32)CC1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H39N8O3P/c1-18(2)35(19(3)4)39(37-13-9-11-28)38-23-15-21(14-20(23)5)34-27-24(25(32-34)22-10-8-12-36-22)26(29-16-30-27)31-17-33(6)7/h8,10,12,16-21,23H,9,13-15H2,1-7H3/b31-17- |
| InChIKey | ATSAQYDBKGKPFI-LJUMEUDFSA-N |
| XLogP | 5.94 |
| TPSA | 117.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|