C20H22N4O9 — CID 71733571
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-oxo-1-[(E)-3-oxobut-1-enyl]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 71733571) has the molecular formula C20H22N4O9 and a molecular weight of 462.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-oxo-1-[(E)-3-oxobut-1-enyl]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-oxo-1-[(E)-3-oxobut-1-enyl]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71733571 |
| Molecular Formula | C20H22N4O9 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-oxo-1-[(E)-3-oxobut-1-enyl]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)/C=C/n1cnc2c(ncn2[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)c1=O |
| InChI | InChI=1S/C20H22N4O9/c1-10(25)5-6-23-8-22-18-15(19(23)29)21-9-24(18)20-17(32-13(4)28)16(31-12(3)27)14(33-20)7-30-11(2)26/h5-6,8-9,14,16-17,20H,7H2,1-4H3/b6-5+/t14-,16-,17-,20-/m1/s1 |
| InChIKey | IBZUZYKVPASFGB-YMPSLQATSA-N |
| XLogP | -0.02 |
| TPSA | 157.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|