C26H28N2O11S2 — CID 46930491
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2-(methylsulfanylcarbothioylamino)-2-oxoacetyl]indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 46930491) has the molecular formula C26H28N2O11S2 and a molecular weight of 608.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2-(methylsulfanylcarbothioylamino)-2-oxoacetyl]indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2-(methylsulfanylcarbothioylamino)-2-oxoacetyl]indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46930491 |
| Molecular Formula | C26H28N2O11S2 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-[2-(methylsulfanylcarbothioylamino)-2-oxoacetyl]indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CSC(=S)NC(=O)C(=O)c1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C26H28N2O11S2/c1-12(29)35-11-19-21(36-13(2)30)22(37-14(3)31)23(38-15(4)32)25(39-19)28-10-17(16-8-6-7-9-18(16)28)20(33)24(34)27-26(40)41-5/h6-10,19,21-23,25H,11H2,1-5H3,(H,27,34,40)/t19-,21-,22+,23-,25-/m1/s1 |
| InChIKey | ZQUTVNICHDLLNQ-FGBFUVBKSA-N |
| XLogP | 1.84 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|