C26H30N2O11S — CID 11767023
[(2R,3R,4S,5R,6S)-6-[(E)-C-[(1-acetylindol-3-yl)methyl]-N-hydroxycarbonimidoyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 11767023) has the molecular formula C26H30N2O11S and a molecular weight of 578.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[(E)-C-[(1-acetylindol-3-yl)methyl]-N-hydroxycarbonimidoyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[(E)-C-[(1-acetylindol-3-yl)methyl]-N-hydroxycarbonimidoyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11767023 |
| Molecular Formula | C26H30N2O11S |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[(E)-C-[(1-acetylindol-3-yl)methyl]-N-hydroxycarbonimidoyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S/C(Cc2cn(C(C)=O)c3ccccc23)=N/O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H30N2O11S/c1-13(29)28-11-18(19-8-6-7-9-20(19)28)10-22(27-34)40-26-25(38-17(5)33)24(37-16(4)32)23(36-15(3)31)21(39-26)12-35-14(2)30/h6-9,11,21,23-26,34H,10,12H2,1-5H3/b27-22+/t21-,23-,24+,25-,26+/m1/s1 |
| InChIKey | ZGPFCOVGSOTSBB-OLJLKJJNSA-N |
| XLogP | 2.45 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|