C28H41NO14S2Si — CID 56834555
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-C-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 56834555) has the molecular formula C28H41NO14S2Si and a molecular weight of 707.85 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-C-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-C-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 56834555 |
| Molecular Formula | C28H41NO14S2Si |
| Molecular Weight | 707.85 g/mol |
| Exact Mass | 707.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-C-[[2-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-N-sulfooxycarbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S/C(Cc2ccccc2O[Si](C)(C)C(C)(C)C)=N\OS(=O)(=O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H41NO14S2Si/c1-16(30)37-15-22-24(38-17(2)31)25(39-18(3)32)26(40-19(4)33)27(41-22)44-23(29-43-45(34,35)36)14-20-12-10-11-13-21(20)42-46(8,9)28(5,6)7/h10-13,22,24-27H,14-15H2,1-9H3,(H,34,35,36)/b29-23-/t22-,24-,25+,26-,27+/m1/s1 |
| InChIKey | BGDMVHYBBJQAJX-NLUBZIJASA-N |
| XLogP | 3.56 |
| TPSA | 199.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|