C25H33NO16S2 — CID 163032385
[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[N-sulfooxy-C-[(3,4,5-trimethoxyphenyl)methyl]carbonimidoyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 163032385) has the molecular formula C25H33NO16S2 and a molecular weight of 667.66 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[N-sulfooxy-C-[(3,4,5-trimethoxyphenyl)methyl]carbonimidoyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[N-sulfooxy-C-[(3,4,5-trimethoxyphenyl)methyl]carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163032385 |
| Molecular Formula | C25H33NO16S2 |
| Molecular Weight | 667.66 g/mol |
| Exact Mass | 667.12 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[N-sulfooxy-C-[(3,4,5-trimethoxyphenyl)methyl]carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | COc1cc(CC(=NOS(=O)(=O)O)S[C@@H]2O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H33NO16S2/c1-12(27)37-11-19-22(38-13(2)28)23(39-14(3)29)24(40-15(4)30)25(41-19)43-20(26-42-44(31,32)33)10-16-8-17(34-5)21(36-7)18(9-16)35-6/h8-9,19,22-25H,10-11H2,1-7H3,(H,31,32,33)/t19-,22-,23+,24+,25-/m0/s1 |
| InChIKey | SCFJNSRGNUASOM-SXGYVVAPSA-N |
| XLogP | 1.20 |
| TPSA | 218.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.66 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|