C20H31NO11S2 — CID 71315830
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-N-hydroxy-C-(4-methylsulfinylbutyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 71315830) has the molecular formula C20H31NO11S2 and a molecular weight of 525.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-N-hydroxy-C-(4-methylsulfinylbutyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-N-hydroxy-C-(4-methylsulfinylbutyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71315830 |
| Molecular Formula | C20H31NO11S2 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(Z)-N-hydroxy-C-(4-methylsulfinylbutyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S/C(CCCCS(C)=O)=N\O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H31NO11S2/c1-11(22)28-10-15-17(29-12(2)23)18(30-13(3)24)19(31-14(4)25)20(32-15)33-16(21-26)8-6-7-9-34(5)27/h15,17-20,26H,6-10H2,1-5H3/b21-16-/t15-,17-,18+,19-,20+,34?/m1/s1 |
| InChIKey | RAKGKLGSLMTYBD-GKJUWVKVSA-N |
| XLogP | 1.14 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|