C19H22N4O10 — CID 124772930
[(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-oxo-1H-pyrazolo[5,4-d]pyrimidin-5-yl)oxan-2-yl]methyl acetate (PubChem CID 124772930) has the molecular formula C19H22N4O10 and a molecular weight of 466.40 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-oxo-1H-pyrazolo[5,4-d]pyrimidin-5-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-oxo-1H-pyrazolo[5,4-d]pyrimidin-5-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124772930 |
| Molecular Formula | C19H22N4O10 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-oxo-1H-pyrazolo[5,4-d]pyrimidin-5-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](n2cnc3[nH]ncc3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H22N4O10/c1-8(24)29-6-13-14(30-9(2)25)15(31-10(3)26)16(32-11(4)27)19(33-13)23-7-20-17-12(18(23)28)5-21-22-17/h5,7,13-16,19H,6H2,1-4H3,(H,21,22)/t13-,14-,15-,16+,19-/m0/s1 |
| InChIKey | NXLUSDAHBPGUAA-ZAHIEGGZSA-N |
| XLogP | -0.62 |
| TPSA | 178.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|