C16H19ClN4O7 — CID 58021118
[(2R,3S,5R)-3,4-diacetyloxy-5-(6-chloro-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 58021118) has the molecular formula C16H19ClN4O7 and a molecular weight of 414.80 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4-diacetyloxy-5-(6-chloro-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3,4-diacetyloxy-5-(6-chloro-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58021118 |
| Molecular Formula | C16H19ClN4O7 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [(2R,3S,5R)-3,4-diacetyloxy-5-(6-chloro-3,6-dihydropurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c2NC=NC3Cl)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H19ClN4O7/c1-7(22)25-4-10-12(26-8(2)23)13(27-9(3)24)16(28-10)21-6-20-11-14(17)18-5-19-15(11)21/h5-6,10,12-14,16H,4H2,1-3H3,(H,18,19)/t10-,12+,13?,14?,16-/m1/s1 |
| InChIKey | KTDXXAQLUKEMOH-SBRPMQCUSA-N |
| XLogP | 0.90 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|