C16H21N4O7PS — CID 90393004
[(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-(2-phosphanylethoxy)oxolan-2-yl]methyl acetate (PubChem CID 90393004) has the molecular formula C16H21N4O7PS and a molecular weight of 444.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-(2-phosphanylethoxy)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-(2-phosphanylethoxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90393004 |
| Molecular Formula | C16H21N4O7PS |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | [(2R,3S,4R,5R)-4-acetyloxy-5-(5-amino-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3-(2-phosphanylethoxy)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(=O)sc3cnc(N)nc32)[C@H](OC(C)=O)[C@H]1OCCP |
| InChI | InChI=1S/C16H21N4O7PS/c1-7(21)25-6-9-11(24-3-4-28)12(26-8(2)22)14(27-9)20-13-10(29-16(20)23)5-18-15(17)19-13/h5,9,11-12,14H,3-4,6,28H2,1-2H3,(H2,17,18,19)/t9-,11+,12-,14-/m1/s1 |
| InChIKey | RIGCXCPHCJHYQR-RFVSLCSESA-N |
| XLogP | 0.09 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|