C16H26N4O5SSi — CID 137190221
5-amino-3-[(2R,3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 137190221) has the molecular formula C16H26N4O5SSi and a molecular weight of 414.56 g/mol. Its IUPAC name is 5-amino-3-[(2R,3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2R,3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 137190221 |
| Molecular Formula | C16H26N4O5SSi |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-amino-3-[(2R,3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](O)[C@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C16H26N4O5SSi/c1-16(2,3)27(4,5)24-7-8-6-9(21)13(25-8)20-11-10(26-15(20)23)12(22)19-14(17)18-11/h8-9,13,21H,6-7H2,1-5H3,(H3,17,18,19,22)/t8-,9-,13+/m0/s1 |
| InChIKey | VLGCZKDJKUHPLH-MWODSPESSA-N |
| XLogP | 1.40 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|