C14H20N4O4S — CID 162121995
5-amino-3-[(2R,3S,5R)-5-ethyl-3-(2-hydroxypropan-2-yl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 162121995) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 5-amino-3-[(2R,3S,5R)-5-ethyl-3-(2-hydroxypropan-2-yl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2R,3S,5R)-5-ethyl-3-(2-hydroxypropan-2-yl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 162121995 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-amino-3-[(2R,3S,5R)-5-ethyl-3-(2-hydroxypropan-2-yl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CC[C@@H]1C[C@@H](C(C)(C)O)[C@H](n2c(=O)sc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C14H20N4O4S/c1-4-6-5-7(14(2,3)21)11(22-6)18-9-8(23-13(18)20)10(19)17-12(15)16-9/h6-7,11,21H,4-5H2,1-3H3,(H3,15,16,17,19)/t6-,7-,11-/m1/s1 |
| InChIKey | ZHNNBODPAZJKRC-OPVBNTEQSA-N |
| XLogP | 0.81 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |