C12H14N4O6S — CID 135453230
[(2R,3R,5S)-2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 135453230) has the molecular formula C12H14N4O6S and a molecular weight of 342.33 g/mol. Its IUPAC name is [(2R,3R,5S)-2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5S)-2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 135453230 |
| Molecular Formula | C12H14N4O6S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [(2R,3R,5S)-2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](CO)O[C@H]1n1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H14N4O6S/c1-4(18)21-6-2-5(3-17)22-10(6)16-8-7(23-12(16)20)9(19)15-11(13)14-8/h5-6,10,17H,2-3H2,1H3,(H3,13,14,15,19)/t5-,6+,10+/m0/s1 |
| InChIKey | VLUVPBONHLFKSJ-BAJZRUMYSA-N |
| XLogP | -1.06 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |