C11H16N5O9P — CID 137012424
[5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 137012424) has the molecular formula C11H16N5O9P and a molecular weight of 393.25 g/mol. Its IUPAC name is [5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 137012424 |
| Molecular Formula | C11H16N5O9P |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCC1OC(n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)C(O)C1O |
| InChI | InChI=1S/C11H16N5O9P/c1-23-26(21,22)24-2-3-5(17)6(18)9(25-3)16-7-4(13-11(16)20)8(19)15-10(12)14-7/h3,5-6,9,17-18H,2H2,1H3,(H,13,20)(H,21,22)(H3,12,14,15,19) |
| InChIKey | SMIASJNIFYHOPR-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 215.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|