C22H43NO4Si — CID 23577213
propan-2-yl 7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxopiperidin-1-yl]heptanoate (PubChem CID 23577213) has the molecular formula C22H43NO4Si and a molecular weight of 413.68 g/mol. Its IUPAC name is propan-2-yl 7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxopiperidin-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxopiperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 23577213 |
| Molecular Formula | C22H43NO4Si |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | propan-2-yl 7-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)CCCC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43NO4Si/c1-18(2)27-21(25)15-10-8-9-11-16-23-19(13-12-14-20(23)24)17-26-28(6,7)22(3,4)5/h18-19H,8-17H2,1-7H3 |
| InChIKey | ZEKQGYCHRLESFP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|