C32H56N2O8 — CID 159525120
propan-2-yl 7-[(2R)-2-formyl-6-oxopiperidin-1-yl]heptanoate;propan-2-yl 7-[(2R)-2-(hydroxymethyl)-6-oxopiperidin-1-yl]heptanoate (PubChem CID 159525120) has the molecular formula C32H56N2O8 and a molecular weight of 596.81 g/mol. Its IUPAC name is propan-2-yl 7-[(2R)-2-formyl-6-oxopiperidin-1-yl]heptanoate;propan-2-yl 7-[(2R)-2-(hydroxymethyl)-6-oxopiperidin-1-yl]heptanoate.
| Compound Name | propan-2-yl 7-[(2R)-2-formyl-6-oxopiperidin-1-yl]heptanoate;propan-2-yl 7-[(2R)-2-(hydroxymethyl)-6-oxopiperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 159525120 |
| Molecular Formula | C32H56N2O8 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | propan-2-yl 7-[(2R)-2-formyl-6-oxopiperidin-1-yl]heptanoate;propan-2-yl 7-[(2R)-2-(hydroxymethyl)-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCCN1C(=O)CCC[C@@H]1C=O.CC(C)OC(=O)CCCCCCN1C(=O)CCC[C@@H]1CO |
| InChI | InChI=1S/C16H29NO4.C16H27NO4/c2*1-13(2)21-16(20)10-5-3-4-6-11-17-14(12-18)8-7-9-15(17)19/h13-14,18H,3-12H2,1-2H3;12-14H,3-11H2,1-2H3/t2*14-/m11/s1 |
| InChIKey | MCHCZJMAXLPMDT-RPERETBRSA-N |
| XLogP | 4.73 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|