C14H21NO4 — CID 69020340
methyl 7-[2-(hydroxymethyl)-6-oxopiperidin-1-yl]hept-5-ynoate (PubChem CID 69020340) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 7-[2-(hydroxymethyl)-6-oxopiperidin-1-yl]hept-5-ynoate.
| Compound Name | methyl 7-[2-(hydroxymethyl)-6-oxopiperidin-1-yl]hept-5-ynoate |
|---|---|
| PubChem CID | 69020340 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 7-[2-(hydroxymethyl)-6-oxopiperidin-1-yl]hept-5-ynoate |
| SMILES | COC(=O)CCCC#CCN1C(=O)CCCC1CO |
| InChI | InChI=1S/C14H21NO4/c1-19-14(18)9-4-2-3-5-10-15-12(11-16)7-6-8-13(15)17/h12,16H,2,4,6-11H2,1H3 |
| InChIKey | MLDBRFQUMGXUNR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|