C22H27NO5 — CID 71126020
7-[(2R)-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid (PubChem CID 71126020) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 7-[(2R)-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid.
| Compound Name | 7-[(2R)-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 71126020 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-[(2R)-2-[(E)-3-hydroxy-4-phenoxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-ynoic acid |
| SMILES | O=C(O)CCCC#CCN1C(=O)CCC[C@@H]1/C=C/C(O)COc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c24-19(17-28-20-10-4-3-5-11-20)15-14-18-9-8-12-21(25)23(18)16-7-2-1-6-13-22(26)27/h3-5,10-11,14-15,18-19,24H,1,6,8-9,12-13,16-17H2,(H,26,27)/b15-14+/t18-,19?/m1/s1 |
| InChIKey | JIYINFYULSWPAK-JYQXRGBBSA-N |
| XLogP | 2.62 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|